CAS 10185-68-9 appears in our catalog under these names: 4-(5-methyl-1,2,4-oxadiazol-3-yl)aniline, 98%, 4-(5-Methyl-1,2,4-oxadiazol-3-yl)aniline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 0,5g.
4-(5-methyl-1,2,4-oxadiazol-3-yl)aniline (CAS 10185-68-9) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 4-(5-methyl-1,2,4-oxadiazol-3-yl)aniline. InChIKey: GXOWTIUKDYSZKJ-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 4-(5-methyl-1,2,4-oxadiazol-3-yl)aniline |
| InChIKey | GXOWTIUKDYSZKJ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)