CAS 1018502-06-1 appears in our catalog under these names: 3-Amino-4-chloro-n-(3-pyridylmethyl)benzamide, 95%, 3-Amino-4-chloro-N-(3-pyridylmethyl)benzamide, 95+%, 3–Amino–4–chloro–N–(3–pyridylmethyl)benzamide. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g.
3-amino-4-chloro-N-(pyridin-3-ylmethyl)benzamide (CAS 1018502-06-1) is a chemical compound with the molecular formula C13H12ClN3O and a molecular weight of 261.70 g/mol. IUPAC name: 3-amino-4-chloro-N-(pyridin-3-ylmethyl)benzamide. InChIKey: TUTGNXCAERCAHY-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN3O |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | 3-amino-4-chloro-N-(pyridin-3-ylmethyl)benzamide |
| InChIKey | TUTGNXCAERCAHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CNC(=O)C2=CC(=C(C=C2)Cl)N |
Computed by PubChem (NCBI)