CAS 1182979-49-2 is the registry number for 2-Chloro-4-(((3,5-dimethylisoxazol-4-yl)methyl)amino)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]benzonitrile (CAS 1182979-49-2) is a chemical compound with the molecular formula C13H12ClN3O and a molecular weight of 261.70 g/mol. IUPAC name: 2-chloro-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]benzonitrile. InChIKey: HEQIRVOPMURJCH-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN3O |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | 2-chloro-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]benzonitrile |
| InChIKey | HEQIRVOPMURJCH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CNC2=CC(=C(C=C2)C#N)Cl |
Computed by PubChem (NCBI)