CAS 1421933-38-1 is the registry number for 2,3-Diamino-n-(4-chlorophenyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
2,3-diamino-N-(4-chlorophenyl)benzamide (CAS 1421933-38-1) is a chemical compound with the molecular formula C13H12ClN3O and a molecular weight of 261.70 g/mol. IUPAC name: 2,3-diamino-N-(4-chlorophenyl)benzamide. InChIKey: YFMRZGCBVRQZSO-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN3O |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | 2,3-diamino-N-(4-chlorophenyl)benzamide |
| InChIKey | YFMRZGCBVRQZSO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)N)C(=O)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)