CAS 743451-15-2 is the registry number for 4-Chloro-2-(1,3-dimethyl-2,3-dihydro-1H-1,3-benzodiazol-2-ylidene)-3-oxobutanenitrile, 95%. Offered by: AmBeed. Available pack sizes: 10g.
4-chloro-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile (CAS 743451-15-2) is a chemical compound with the molecular formula C13H12ClN3O and a molecular weight of 261.70 g/mol. IUPAC name: 4-chloro-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile. InChIKey: TXVLWCJETIWPJL-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN3O |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | 4-chloro-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile |
| InChIKey | TXVLWCJETIWPJL-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2N(C1=C(C#N)C(=O)CCl)C |
Computed by PubChem (NCBI)