CAS 97627-24-2 appears in our catalog under these names: N-(2-Chloro-6-methylphenyl)-N'-4-pyridinylurea, N-(2-Chloro-6-methylphenyl)-N'-4-pyridinylurea/ 99.76% (existing batch purity), 1-(2-Chloro-6-methylphenyl)-3-(pyridin-4-yl)urea, 99%, 99%, N-(2-Chloro-6-methylphenyl)-N'-4-pyridinylurea, 99.73%. Offered by: Biosynth, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1mg, 100mg, 500mg, 50 mg.
1-(2-chloro-6-methylphenyl)-3-pyridin-4-ylurea (CAS 97627-24-2) is a chemical compound with the molecular formula C13H12ClN3O and a molecular weight of 261.70 g/mol. IUPAC name: 1-(2-chloro-6-methylphenyl)-3-pyridin-4-ylurea. InChIKey: ZSBWDKCIIZYQIR-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN3O |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | 1-(2-chloro-6-methylphenyl)-3-pyridin-4-ylurea |
| InChIKey | ZSBWDKCIIZYQIR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Cl)NC(=O)NC2=CC=NC=C2 |
Computed by PubChem (NCBI)