CAS 1018611-90-9 is the registry number for (1,1-Dioxidotetrahydrothiophen-3-yl)methanesulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g, 1g.
(1,1-dioxothiolan-3-yl)methanesulfonyl chloride (CAS 1018611-90-9) is a chemical compound with the molecular formula C5H9ClO4S2 and a molecular weight of 232.7 g/mol. IUPAC name: (1,1-dioxothiolan-3-yl)methanesulfonyl chloride. InChIKey: GVGQILJHSCPTFL-UHFFFAOYSA-N.
| Molecular formula | C5H9ClO4S2 |
|---|---|
| Molecular weight | 232.7 g/mol |
| IUPAC name | (1,1-dioxothiolan-3-yl)methanesulfonyl chloride |
| InChIKey | GVGQILJHSCPTFL-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1CS(=O)(=O)Cl |
Computed by PubChem (NCBI)