Products 2091110-80-2

CAS 2091110-80-2 appears in our catalog under these names: (3-Methyl-1,1-dioxidothietan-3-yl)methanesulfonyl chloride, 95%, 3-​Methyl-​3-​thietanemethanesulfo​nyl chloride 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

(3-methyl-1,1-dioxothietan-3-yl)methanesulfonyl chloride (CAS 2091110-80-2) is a chemical compound with the molecular formula C5H9ClO4S2 and a molecular weight of 232.7 g/mol. IUPAC name: (3-methyl-1,1-dioxothietan-3-yl)methanesulfonyl chloride. InChIKey: GIWQQKGRNLBLRI-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClO4S2
Molecular weight232.7 g/mol
IUPAC name(3-methyl-1,1-dioxothietan-3-yl)methanesulfonyl chloride
InChIKeyGIWQQKGRNLBLRI-UHFFFAOYSA-N
SMILESCC1(CS(=O)(=O)C1)CS(=O)(=O)Cl

Computed by PubChem (NCBI)