Products 1955530-78-5

CAS 1955530-78-5 appears in our catalog under these names: (1,1-Dioxidotetrahydrothiophen-2-yl)methanesulfonyl chloride, 95%, (1,1-Dioxo-1λâ¶-thiolan-2-yl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.

(1,1-dioxothiolan-2-yl)methanesulfonyl chloride (CAS 1955530-78-5) is a chemical compound with the molecular formula C5H9ClO4S2 and a molecular weight of 232.7 g/mol. IUPAC name: (1,1-dioxothiolan-2-yl)methanesulfonyl chloride. InChIKey: DCELEPTVAWCRCY-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClO4S2
Molecular weight232.7 g/mol
IUPAC name(1,1-dioxothiolan-2-yl)methanesulfonyl chloride
InChIKeyDCELEPTVAWCRCY-UHFFFAOYSA-N
SMILESC1CC(S(=O)(=O)C1)CS(=O)(=O)Cl

Computed by PubChem (NCBI)