CAS 1221722-37-7 appears in our catalog under these names: Tetrahydro-2H-thiopyran-4-sulfonyl chloride 1,1-dioxide, 98%, Tetrahydro-2H-thiopyran-4-sulfonyl Chloride 1,1-Dioxide. Offered by: AmBeed, TRC, Biosynth. Available pack sizes: 5g, 1g, 100mg, 50mg, 0,5g.
1,1-dioxothiane-4-sulfonyl chloride (CAS 1221722-37-7) is a chemical compound with the molecular formula C5H9ClO4S2 and a molecular weight of 232.7 g/mol. IUPAC name: 1,1-dioxothiane-4-sulfonyl chloride. InChIKey: VVMQCBWGPRBGDH-UHFFFAOYSA-N.
| Molecular formula | C5H9ClO4S2 |
|---|---|
| Molecular weight | 232.7 g/mol |
| IUPAC name | 1,1-dioxothiane-4-sulfonyl chloride |
| InChIKey | VVMQCBWGPRBGDH-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1S(=O)(=O)Cl |
Computed by PubChem (NCBI)