Products 1888879-40-0

CAS 1888879-40-0 appears in our catalog under these names: 2-(1,1-Dioxo-1lambda6-thietan-3-yl)ethane-1-sulfonyl chloride, 95%, 2-(1,1-Dioxo-1λâ¶-thietan-3-yl)ethane-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2-(1,1-dioxothietan-3-yl)ethanesulfonyl chloride (CAS 1888879-40-0) is a chemical compound with the molecular formula C5H9ClO4S2 and a molecular weight of 232.7 g/mol. IUPAC name: 2-(1,1-dioxothietan-3-yl)ethanesulfonyl chloride. InChIKey: LUVWLRMRKXMDHK-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClO4S2
Molecular weight232.7 g/mol
IUPAC name2-(1,1-dioxothietan-3-yl)ethanesulfonyl chloride
InChIKeyLUVWLRMRKXMDHK-UHFFFAOYSA-N
SMILESC1C(CS1(=O)=O)CCS(=O)(=O)Cl

Computed by PubChem (NCBI)