CAS 1018617-68-9 is the registry number for 5-Amino-3-(prop-2-en-1-yl)-2,3-dihydro-1,3-benzoxazol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-amino-3-prop-2-enyl-1,3-benzoxazol-2-one (CAS 1018617-68-9) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 5-amino-3-prop-2-enyl-1,3-benzoxazol-2-one. InChIKey: TXMSVPXJJWVFDY-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 5-amino-3-prop-2-enyl-1,3-benzoxazol-2-one |
| InChIKey | TXMSVPXJJWVFDY-UHFFFAOYSA-N |
| SMILES | C=CCN1C2=C(C=CC(=C2)N)OC1=O |
Computed by PubChem (NCBI)