Products 1018978-81-8
CAS 1018978-81-8 is the registry number for N-(8-Fluoro-3,4-dihydro-2H-1-benzopyran-4-ylidene)hydroxylamine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
(NE)-N-(8-fluoro-2,3-dihydrochromen-4-ylidene)hydroxylamine (CAS 1018978-81-8) is a chemical compound with the molecular formula C9H8FNO2 and a molecular weight of 181.16 g/mol. IUPAC name: (NE)-N-(8-fluoro-2,3-dihydrochromen-4-ylidene)hydroxylamine. InChIKey: OFOMMTJRFCSXNT-DHZHZOJOSA-N.
| Molecular formula | C9H8FNO2 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | (NE)-N-(8-fluoro-2,3-dihydrochromen-4-ylidene)hydroxylamine |
| InChIKey | OFOMMTJRFCSXNT-DHZHZOJOSA-N |
| SMILES | C\1COC2=C(/C1=N/O)C=CC=C2F |
Computed by PubChem (NCBI)