CAS 1019111-25-1 is the registry number for 8-Chloro-1,7-naphthyridine-6-carboxylic Acid. Offered by: TRC. Available pack sizes: 1g.
8-chloro-1,7-naphthyridine-6-carboxylic acid (CAS 1019111-25-1) is a chemical compound with the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. IUPAC name: 8-chloro-1,7-naphthyridine-6-carboxylic acid. InChIKey: YLISLRCKZWMAIW-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O2 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 8-chloro-1,7-naphthyridine-6-carboxylic acid |
| InChIKey | YLISLRCKZWMAIW-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=NC(=C2N=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)