Products 1019127-19-5
CAS 1019127-19-5 is the registry number for 2-(Cyclopentylamino)isonicotinic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(cyclopentylamino)pyridine-4-carboxylic acid (CAS 1019127-19-5) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: 2-(cyclopentylamino)pyridine-4-carboxylic acid. InChIKey: NNHLQOZJRIRQQU-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2-(cyclopentylamino)pyridine-4-carboxylic acid |
| InChIKey | NNHLQOZJRIRQQU-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC2=NC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)