CAS 1019164-34-1 is the registry number for 4-Chloro-2-phenylpyrazolo(1,5-a)pyrazine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-chloro-2-phenylpyrazolo[1,5-a]pyrazine (CAS 1019164-34-1) is a chemical compound with the molecular formula C12H8ClN3 and a molecular weight of 229.66 g/mol. IUPAC name: 4-chloro-2-phenylpyrazolo[1,5-a]pyrazine. InChIKey: ACCBQSBWDNAFOE-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 4-chloro-2-phenylpyrazolo[1,5-a]pyrazine |
| InChIKey | ACCBQSBWDNAFOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN3C=CN=C(C3=C2)Cl |
Computed by PubChem (NCBI)