Products 1019357-55-1
CAS 1019357-55-1 is the registry number for 5-Chloro-6-(prop-2-yn-1-ylamino)nicotinic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-chloro-6-(prop-2-ynylamino)pyridine-3-carboxylic acid (CAS 1019357-55-1) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 5-chloro-6-(prop-2-ynylamino)pyridine-3-carboxylic acid. InChIKey: LLCLLNXVAISGOF-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 5-chloro-6-(prop-2-ynylamino)pyridine-3-carboxylic acid |
| InChIKey | LLCLLNXVAISGOF-UHFFFAOYSA-N |
| SMILES | C#CCNC1=C(C=C(C=N1)C(=O)O)Cl |
Computed by PubChem (NCBI)