CAS 1019365-00-4 is the registry number for 4-((4-Methyl-1,3-thiazol-2-yl)sulfanyl)aniline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline (CAS 1019365-00-4) is a chemical compound with the molecular formula C10H10N2S2 and a molecular weight of 222.3 g/mol. IUPAC name: 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline. InChIKey: RWSDQMBAKOAUAQ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S2 |
|---|---|
| Molecular weight | 222.3 g/mol |
| IUPAC name | 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline |
| InChIKey | RWSDQMBAKOAUAQ-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)SC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)