CAS 40277-39-2 is the registry number for 8-thia-4,6-diazatricyclo[7.4.0.0²,â·]trideca-1(9),2(7),5-triene-3-thione, 96%. Offered by: Fluorochem. Available pack sizes: 100mg.
5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-4-thione (CAS 40277-39-2) is a chemical compound with the molecular formula C10H10N2S2 and a molecular weight of 222.3 g/mol. IUPAC name: 5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-4-thione. InChIKey: KUZMWCUBXLBJQY-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S2 |
|---|---|
| Molecular weight | 222.3 g/mol |
| IUPAC name | 5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-4-thione |
| InChIKey | KUZMWCUBXLBJQY-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(S2)N=CNC3=S |
Computed by PubChem (NCBI)