CAS 1873527-23-1 is the registry number for N-(Thietan-3-yl)benzo[d]thiazol-6-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(thietan-3-yl)-1,3-benzothiazol-6-amine (CAS 1873527-23-1) is a chemical compound with the molecular formula C10H10N2S2 and a molecular weight of 222.3 g/mol. IUPAC name: N-(thietan-3-yl)-1,3-benzothiazol-6-amine. InChIKey: JQYIQEJUWJTGOX-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S2 |
|---|---|
| Molecular weight | 222.3 g/mol |
| IUPAC name | N-(thietan-3-yl)-1,3-benzothiazol-6-amine |
| InChIKey | JQYIQEJUWJTGOX-UHFFFAOYSA-N |
| SMILES | C1C(CS1)NC2=CC3=C(C=C2)N=CS3 |
Computed by PubChem (NCBI)