CAS 105512-85-4 appears in our catalog under these names: 4-(4-Methylsulfanylphenyl)-thiazol-2-ylamine, 97%, 4-(4-(Methylthio)phenyl)thiazol-2-amine 95+%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-(4-methylsulfanylphenyl)-1,3-thiazol-2-amine (CAS 105512-85-4) is a chemical compound with the molecular formula C10H10N2S2 and a molecular weight of 222.3 g/mol. IUPAC name: 4-(4-methylsulfanylphenyl)-1,3-thiazol-2-amine. InChIKey: YSUNRHCYOWYXOJ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S2 |
|---|---|
| Molecular weight | 222.3 g/mol |
| IUPAC name | 4-(4-methylsulfanylphenyl)-1,3-thiazol-2-amine |
| InChIKey | YSUNRHCYOWYXOJ-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)