CAS 1019402-77-7 appears in our catalog under these names: 4-Chloro-n-cyclopropyl-2-hydroxybenzamide, 95%, 4-Chloro-N-cyclopropyl-2-hydroxybenzamide, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 500mg, 250mg, 1g.
4-chloro-N-cyclopropyl-2-hydroxybenzamide (CAS 1019402-77-7) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: 4-chloro-N-cyclopropyl-2-hydroxybenzamide. InChIKey: DQIUYALTBJYXGX-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | 4-chloro-N-cyclopropyl-2-hydroxybenzamide |
| InChIKey | DQIUYALTBJYXGX-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=C(C=C(C=C2)Cl)O |
Computed by PubChem (NCBI)