CAS 1019466-68-2 appears in our catalog under these names: N-Cyclopropyl-3-hydroxybenzamide, 98%, N-Cyclopropyl-3-hydroxybenzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 0,5g.
N-cyclopropyl-3-hydroxybenzamide (CAS 1019466-68-2) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: N-cyclopropyl-3-hydroxybenzamide. InChIKey: RARPTIBEFUNWRF-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | N-cyclopropyl-3-hydroxybenzamide |
| InChIKey | RARPTIBEFUNWRF-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)