Products 1020252-16-7
CAS 1020252-16-7 is the registry number for 3-((4-Acetylphenyl)amino)-5-phenylcyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg.
3-(4-acetylanilino)-5-phenylcyclohex-2-en-1-one (CAS 1020252-16-7) is a chemical compound with the molecular formula C20H19NO2 and a molecular weight of 305.4 g/mol. IUPAC name: 3-(4-acetylanilino)-5-phenylcyclohex-2-en-1-one. InChIKey: NBUBXNPNUAUGAE-UHFFFAOYSA-N.
| Molecular formula | C20H19NO2 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 3-(4-acetylanilino)-5-phenylcyclohex-2-en-1-one |
| InChIKey | NBUBXNPNUAUGAE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)NC2=CC(=O)CC(C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)