Products 1020718-78-8
CAS 1020718-78-8 appears in our catalog under these names: 4-Acetaminophen-d3 Sulfate, >95% (HPLC), 4–Acetaminophen–d3 Sulfate, 4-Acetaminophen sulfate-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
[4-[(2,2,2-trideuterioacetyl)amino]phenyl] hydrogen sulfate (CAS 1020718-78-8) is a chemical compound with the molecular formula C8H9NO5S and a molecular weight of 234.25 g/mol. IUPAC name: [4-[(2,2,2-trideuterioacetyl)amino]phenyl] hydrogen sulfate. InChIKey: IGTYILLPRJOVFY-FIBGUPNXSA-N.
| Molecular formula | C8H9NO5S |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | [4-[(2,2,2-trideuterioacetyl)amino]phenyl] hydrogen sulfate |
| InChIKey | IGTYILLPRJOVFY-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NC1=CC=C(C=C1)OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Acetaminophen-d3 Sulfate, 4-Acetaminophen sulfate-d3, [4-[(2,2,2-trideuterioacetyl)amino]phenyl] hydrogen sulfate, {4-[(2,2,2-?H?)acetamido]phenyl}oxidanesulfonic acid, 4-[(~2~H_3_)Ethanoylamino]phenyl hydrogen sulfate, 4-(~2~H_3_)Ethanamidophenyl hydrogen sulfate, Acetamide-2,2,2-d3, N-[4-(sulfooxy)phenyl]-