CAS 1020719-48-5 is the registry number for 2-Hydroxy-1-methyl-6-phenylimidazo(4,5-b)pyridine-d3. Offered by: TRC. Available pack sizes: 10mg, 1mg.
6-phenyl-1-(trideuteriomethyl)-3H-imidazo[4,5-b]pyridin-2-one (CAS 1020719-48-5) is a chemical compound with the molecular formula C13H11N3O and a molecular weight of 228.26 g/mol. IUPAC name: 6-phenyl-1-(trideuteriomethyl)-3H-imidazo[4,5-b]pyridin-2-one. InChIKey: PDYMCBRGMDRAPX-FIBGUPNXSA-N.
| Molecular formula | C13H11N3O |
|---|---|
| Molecular weight | 228.26 g/mol |
| IUPAC name | 6-phenyl-1-(trideuteriomethyl)-3H-imidazo[4,5-b]pyridin-2-one |
| InChIKey | PDYMCBRGMDRAPX-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=C(NC1=O)N=CC(=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)