CAS 120889-04-5 appears in our catalog under these names: 1-Methyl-6-phenyl-1H-imidazo[4,5-b]pyridin-2-ol, 98%, 2-Hydroxy-1-methyl-6-phenylimidazo(4,5-b)pyridine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 25mg.
1-methyl-6-phenyl-3H-imidazo[4,5-b]pyridin-2-one (CAS 120889-04-5) is a chemical compound with the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. IUPAC name: 1-methyl-6-phenyl-3H-imidazo[4,5-b]pyridin-2-one. InChIKey: PDYMCBRGMDRAPX-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 1-methyl-6-phenyl-3H-imidazo[4,5-b]pyridin-2-one |
| InChIKey | PDYMCBRGMDRAPX-UHFFFAOYSA-N |
| SMILES | CN1C2=C(NC1=O)N=CC(=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)