CAS 102096-60-6 is the registry number for (R)-(+)-ALPHA-ACRYLOYLOXY-BETA,BETA-. Offered by: Sigma-Aldrich. Available pack sizes: 5G.
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] prop-2-enoate (CAS 102096-60-6) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] prop-2-enoate. InChIKey: ICMBTQSRUNSRKI-ZETCQYMHSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] prop-2-enoate |
| InChIKey | ICMBTQSRUNSRKI-ZETCQYMHSA-N |
| SMILES | CC1(COC(=O)[C@@H]1OC(=O)C=C)C |
Computed by PubChem (NCBI)