Products 1021015-16-6
CAS 1021015-16-6 is the registry number for (2-Chlorophenyl)(2,5-dimethylphenyl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2-chlorophenyl)-(2,5-dimethylphenyl)methanamine (CAS 1021015-16-6) is a chemical compound with the molecular formula C15H16ClN and a molecular weight of 245.74 g/mol. IUPAC name: (2-chlorophenyl)-(2,5-dimethylphenyl)methanamine. InChIKey: WVAHUVMSUQOYMH-UHFFFAOYSA-N.
| Molecular formula | C15H16ClN |
|---|---|
| Molecular weight | 245.74 g/mol |
| IUPAC name | (2-chlorophenyl)-(2,5-dimethylphenyl)methanamine |
| InChIKey | WVAHUVMSUQOYMH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(C2=CC=CC=C2Cl)N |
Computed by PubChem (NCBI)