Products 1021022-88-7
CAS 1021022-88-7 is the registry number for 2-((1,3-Dioxaindan-5-yl)amino)pyridine-4-carbonitrile. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(1,3-benzodioxol-5-ylamino)pyridine-4-carbonitrile (CAS 1021022-88-7) is a chemical compound with the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-ylamino)pyridine-4-carbonitrile. InChIKey: GRBLSAZHLNSSIC-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O2 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-ylamino)pyridine-4-carbonitrile |
| InChIKey | GRBLSAZHLNSSIC-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NC3=NC=CC(=C3)C#N |
Computed by PubChem (NCBI)