CAS 1021023-54-0 appears in our catalog under these names: 2-(5-Bromo-2,3-dioxo-2,3-dihydro-1H-indol-1-yl)-N,N-dimethylacetamide, 95%, 2-(5-Bromo-2,3-dioxo-2,3-dihydro-1H-indol-1-yl)-N,N-dimethylacetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-(5-bromo-2,3-dioxoindol-1-yl)-N,N-dimethylacetamide (CAS 1021023-54-0) is a chemical compound with the molecular formula C12H11BrN2O3 and a molecular weight of 311.13 g/mol. IUPAC name: 2-(5-bromo-2,3-dioxoindol-1-yl)-N,N-dimethylacetamide. InChIKey: XIKJCKJDZGKICB-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O3 |
|---|---|
| Molecular weight | 311.13 g/mol |
| IUPAC name | 2-(5-bromo-2,3-dioxoindol-1-yl)-N,N-dimethylacetamide |
| InChIKey | XIKJCKJDZGKICB-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CN1C2=C(C=C(C=C2)Br)C(=O)C1=O |
Computed by PubChem (NCBI)