Products 925007-20-1
CAS 925007-20-1 is the registry number for Ethyl 5-amino-4-(4-bromophenyl)isoxazole-3-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 5-amino-4-(4-bromophenyl)-1,2-oxazole-3-carboxylate (CAS 925007-20-1) is a chemical compound with the molecular formula C12H11BrN2O3 and a molecular weight of 311.13 g/mol. IUPAC name: ethyl 5-amino-4-(4-bromophenyl)-1,2-oxazole-3-carboxylate. InChIKey: LVVCDJIULDZABU-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O3 |
|---|---|
| Molecular weight | 311.13 g/mol |
| IUPAC name | ethyl 5-amino-4-(4-bromophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | LVVCDJIULDZABU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)