CAS 889573-80-2 appears in our catalog under these names: 2-Amino-3-(6-bromo-2-oxo-1,2-dihydroquinolin-4-yl)propanoic acid, 98%, Rebamipide Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-3-(6-bromo-2-oxo-1H-quinolin-4-yl)propanoic acid (CAS 889573-80-2) is a chemical compound with the molecular formula C12H11BrN2O3 and a molecular weight of 311.13 g/mol. IUPAC name: 2-amino-3-(6-bromo-2-oxo-1H-quinolin-4-yl)propanoic acid. InChIKey: QWUOQVLEQGDJAU-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O3 |
|---|---|
| Molecular weight | 311.13 g/mol |
| IUPAC name | 2-amino-3-(6-bromo-2-oxo-1H-quinolin-4-yl)propanoic acid |
| InChIKey | QWUOQVLEQGDJAU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CC(=O)N2)CC(C(=O)O)N |
Computed by PubChem (NCBI)