Products 1259045-46-9
CAS 1259045-46-9 is the registry number for 4-Bromo-N-(furan-2-ylmethyl)-N-methyl-2-nitroaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-N-(furan-2-ylmethyl)-N-methyl-2-nitroaniline (CAS 1259045-46-9) is a chemical compound with the molecular formula C12H11BrN2O3 and a molecular weight of 311.13 g/mol. IUPAC name: 4-bromo-N-(furan-2-ylmethyl)-N-methyl-2-nitroaniline. InChIKey: JDZXTXRGWAQRSY-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O3 |
|---|---|
| Molecular weight | 311.13 g/mol |
| IUPAC name | 4-bromo-N-(furan-2-ylmethyl)-N-methyl-2-nitroaniline |
| InChIKey | JDZXTXRGWAQRSY-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CO1)C2=C(C=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)