CAS 207509-46-4 appears in our catalog under these names: 3-((4-Nitrobenzyl)oxy)pyridine, 95%, 3-[(4-Nitrobenzyl)oxy]pyridine hydrobromide, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g.
3-[(4-nitrophenyl)methoxy]pyridine;hydrobromide (CAS 207509-46-4) is a chemical compound with the molecular formula C12H11BrN2O3 and a molecular weight of 311.13 g/mol. IUPAC name: 3-[(4-nitrophenyl)methoxy]pyridine;hydrobromide. InChIKey: PRGRUNRSXXWMOD-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O3 |
|---|---|
| Molecular weight | 311.13 g/mol |
| IUPAC name | 3-[(4-nitrophenyl)methoxy]pyridine;hydrobromide |
| InChIKey | PRGRUNRSXXWMOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)OCC2=CC=C(C=C2)[N+](=O)[O-].Br |
Computed by PubChem (NCBI)