CAS 1021116-42-6 appears in our catalog under these names: 3-Bromo-n-(2,2,2-trifluoroethyl)aniline, 97%, 3-Bromo-N-(2,2,2-trifluoroethyl)aniline, 3-Bromo-n-(2,2,2-trifluoroethyl)aniline, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 1g, 250mg.
3-bromo-N-(2,2,2-trifluoroethyl)aniline (CAS 1021116-42-6) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: 3-bromo-N-(2,2,2-trifluoroethyl)aniline. InChIKey: WJBNMALBHZQVDS-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | 3-bromo-N-(2,2,2-trifluoroethyl)aniline |
| InChIKey | WJBNMALBHZQVDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)NCC(F)(F)F |
Computed by PubChem (NCBI)