Products 1021141-89-8
CAS 1021141-89-8 is the registry number for 2-{1-((tert-Butylcarbamoyl)methyl)-1H-indol-3-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[1-[2-(tert-butylamino)-2-oxoethyl]indol-3-yl]acetic acid (CAS 1021141-89-8) is a chemical compound with the molecular formula C16H20N2O3 and a molecular weight of 288.34 g/mol. IUPAC name: 2-[1-[2-(tert-butylamino)-2-oxoethyl]indol-3-yl]acetic acid. InChIKey: CKFGZTDAGJUZRH-UHFFFAOYSA-N.
| Molecular formula | C16H20N2O3 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | 2-[1-[2-(tert-butylamino)-2-oxoethyl]indol-3-yl]acetic acid |
| InChIKey | CKFGZTDAGJUZRH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)CN1C=C(C2=CC=CC=C21)CC(=O)O |
Computed by PubChem (NCBI)