CAS 102124-73-2 appears in our catalog under these names: 1-(Benzo(d)(1,3)dioxol-5-yl)-2,2,2-trifluoroethanone, 95+%, 3',4'-(Methylenedioxy)-2,2,2-trifluoroacetophenone, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 50mg, 100mg, 250mg, 500mg.
1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethanone (CAS 102124-73-2) is a chemical compound with the molecular formula C9H5F3O3 and a molecular weight of 218.13 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethanone. InChIKey: WSTNSHHKYLVOAE-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O3 |
|---|---|
| Molecular weight | 218.13 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethanone |
| InChIKey | WSTNSHHKYLVOAE-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)