CAS 23984-83-0 is the registry number for 2-Formyl-4-(trifluoromethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
2-formyl-4-(trifluoromethyl)benzoic acid (CAS 23984-83-0) is a chemical compound with the molecular formula C9H5F3O3 and a molecular weight of 218.13 g/mol. IUPAC name: 2-formyl-4-(trifluoromethyl)benzoic acid. InChIKey: RZAMZNJFYLDRSY-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O3 |
|---|---|
| Molecular weight | 218.13 g/mol |
| IUPAC name | 2-formyl-4-(trifluoromethyl)benzoic acid |
| InChIKey | RZAMZNJFYLDRSY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C=O)C(=O)O |
Computed by PubChem (NCBI)