CAS 2228718-97-4 is the registry number for 2-Oxo-3-(2,3,6-trifluorophenyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-oxo-3-(2,3,6-trifluorophenyl)propanoic acid (CAS 2228718-97-4) is a chemical compound with the molecular formula C9H5F3O3 and a molecular weight of 218.13 g/mol. IUPAC name: 2-oxo-3-(2,3,6-trifluorophenyl)propanoic acid. InChIKey: LZLNBHIJEYAWJD-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O3 |
|---|---|
| Molecular weight | 218.13 g/mol |
| IUPAC name | 2-oxo-3-(2,3,6-trifluorophenyl)propanoic acid |
| InChIKey | LZLNBHIJEYAWJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)CC(=O)C(=O)O)F)F |
Computed by PubChem (NCBI)