Products 897027-02-0

CAS 897027-02-0 is the registry number for 2-Oxo-3-(2,3,4-trifluorophenyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-oxo-3-(2,3,4-trifluorophenyl)propanoic acid (CAS 897027-02-0) is a chemical compound with the molecular formula C9H5F3O3 and a molecular weight of 218.13 g/mol. IUPAC name: 2-oxo-3-(2,3,4-trifluorophenyl)propanoic acid. InChIKey: XONRGJWQTFWGLC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5F3O3
Molecular weight218.13 g/mol
IUPAC name2-oxo-3-(2,3,4-trifluorophenyl)propanoic acid
InChIKeyXONRGJWQTFWGLC-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1CC(=O)C(=O)O)F)F)F

Computed by PubChem (NCBI)