CAS 134151-66-9 appears in our catalog under these names: Benzoic acid, 4-[(1,2,2-trifluoroethenyl)oxy]-, 95%, 4-(Trifluorovinyloxy)benzoic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
4-(1,2,2-trifluoroethenoxy)benzoic acid (CAS 134151-66-9) is a chemical compound with the molecular formula C9H5F3O3 and a molecular weight of 218.13 g/mol. IUPAC name: 4-(1,2,2-trifluoroethenoxy)benzoic acid. InChIKey: RSARXEGXWPNARA-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O3 |
|---|---|
| Molecular weight | 218.13 g/mol |
| IUPAC name | 4-(1,2,2-trifluoroethenoxy)benzoic acid |
| InChIKey | RSARXEGXWPNARA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC(=C(F)F)F |
Computed by PubChem (NCBI)