CAS 1021243-16-2 appears in our catalog under these names: 3-Fluoro-4-pyrrolidinobenzoic acid, 95%, 3-Fluoro-4-pyrrolidinobenzoic Acid, 98%, 3–Fluoro–4–pyrrolidinobenzoic Acid, 3-Fluoro-4-(pyrrolidin-1-yl)benzoic acid, 3-Fluoro-4-pyrrolidinobenzoic Acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 10g, 25g, 1g, 5g, 250mg, 2,5g, 100mg.
3-fluoro-4-pyrrolidin-1-ylbenzoic acid (CAS 1021243-16-2) is a chemical compound with the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. IUPAC name: 3-fluoro-4-pyrrolidin-1-ylbenzoic acid. InChIKey: HXPJLYBFMBIXKY-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO2 |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 3-fluoro-4-pyrrolidin-1-ylbenzoic acid |
| InChIKey | HXPJLYBFMBIXKY-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)