CAS 1021262-12-3 is the registry number for 2-(3,4-Dimethylphenyl)pyrazolo[1,5-a]pyrazin-4(5h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(3,4-dimethylphenyl)-5H-pyrazolo[1,5-a]pyrazin-4-one (CAS 1021262-12-3) is a chemical compound with the molecular formula C14H13N3O and a molecular weight of 239.27 g/mol. IUPAC name: 2-(3,4-dimethylphenyl)-5H-pyrazolo[1,5-a]pyrazin-4-one. InChIKey: SOWSUFWSTQBPQV-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 2-(3,4-dimethylphenyl)-5H-pyrazolo[1,5-a]pyrazin-4-one |
| InChIKey | SOWSUFWSTQBPQV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NN3C=CNC(=O)C3=C2)C |
Computed by PubChem (NCBI)