CAS 2007916-00-7 is the registry number for 4-(Imidazo[1,2-a]pyridin-7-yloxy)-2-methylaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-imidazo[1,2-a]pyridin-7-yloxy-2-methylaniline (CAS 2007916-00-7) is a chemical compound with the molecular formula C14H13N3O and a molecular weight of 239.27 g/mol. IUPAC name: 4-imidazo[1,2-a]pyridin-7-yloxy-2-methylaniline. InChIKey: NRWQFAZZGWFFIT-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 4-imidazo[1,2-a]pyridin-7-yloxy-2-methylaniline |
| InChIKey | NRWQFAZZGWFFIT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC2=CC3=NC=CN3C=C2)N |
Computed by PubChem (NCBI)