CAS 364599-60-0 appears in our catalog under these names: 2-[(1H-Benzimidazol-2-ylamino)methyl]phenol, 95%, 2-(((1H-Benzo(d)imidazol-2-yl)amino)methyl)phenol, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 25g, 250mg.
2-[(1H-benzimidazol-2-ylamino)methyl]phenol (CAS 364599-60-0) is a chemical compound with the molecular formula C14H13N3O and a molecular weight of 239.27 g/mol. IUPAC name: 2-[(1H-benzimidazol-2-ylamino)methyl]phenol. InChIKey: OCDMDLRMBVJKCG-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 2-[(1H-benzimidazol-2-ylamino)methyl]phenol |
| InChIKey | OCDMDLRMBVJKCG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC2=NC3=CC=CC=C3N2)O |
Computed by PubChem (NCBI)