CAS 1610688-92-0 is the registry number for 5-[(E)-2-(Dimethylamino)ethenyl]-3-phenyl-1,2-oxazole-4-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-[(E)-2-(dimethylamino)ethenyl]-3-phenyl-1,2-oxazole-4-carbonitrile (CAS 1610688-92-0) is a chemical compound with the molecular formula C14H13N3O and a molecular weight of 239.27 g/mol. IUPAC name: 5-[(E)-2-(dimethylamino)ethenyl]-3-phenyl-1,2-oxazole-4-carbonitrile. InChIKey: AGJHGAJHGLQLHV-CMDGGOBGSA-N.
| Molecular formula | C14H13N3O |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 5-[(E)-2-(dimethylamino)ethenyl]-3-phenyl-1,2-oxazole-4-carbonitrile |
| InChIKey | AGJHGAJHGLQLHV-CMDGGOBGSA-N |
| SMILES | CN(C)/C=C/C1=C(C(=NO1)C2=CC=CC=C2)C#N |
Computed by PubChem (NCBI)