CAS 887399-27-1 is the registry number for 6-((3-Aminophenyl)amino)indolin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
6-(3-aminoanilino)-1,3-dihydroindol-2-one (CAS 887399-27-1) is a chemical compound with the molecular formula C14H13N3O and a molecular weight of 239.27 g/mol. IUPAC name: 6-(3-aminoanilino)-1,3-dihydroindol-2-one. InChIKey: IEFHMBNACJXCJG-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 6-(3-aminoanilino)-1,3-dihydroindol-2-one |
| InChIKey | IEFHMBNACJXCJG-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)NC3=CC=CC(=C3)N)NC1=O |
Computed by PubChem (NCBI)