Products 1021344-69-3

CAS 1021344-69-3 is the registry number for Methyl 4-bromo-2-iodo-6-methylbenzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 4-bromo-2-iodo-6-methylbenzoate (CAS 1021344-69-3) is a chemical compound with the molecular formula C9H8BrIO2 and a molecular weight of 354.97 g/mol. IUPAC name: methyl 4-bromo-2-iodo-6-methylbenzoate. InChIKey: ZSTLHSKWDHIWKM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrIO2
Molecular weight354.97 g/mol
IUPAC namemethyl 4-bromo-2-iodo-6-methylbenzoate
InChIKeyZSTLHSKWDHIWKM-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1C(=O)OC)I)Br

Computed by PubChem (NCBI)