Products 1021422-85-4
CAS 1021422-85-4 is the registry number for Fmoc-DAP-N3. Offered by: Iris Biotech, MedChemExpress. Available pack sizes: 1g, 5g, 25g, 250mg, 500mg, Get quote.
9H-fluoren-9-ylmethyl N-(3-azidopropyl)carbamate (CAS 1021422-85-4) is a chemical compound with the molecular formula C18H18N4O2 and a molecular weight of 322.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(3-azidopropyl)carbamate. InChIKey: XXWDONRFYHZMAK-UHFFFAOYSA-N.
| Molecular formula | C18H18N4O2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(3-azidopropyl)carbamate |
| InChIKey | XXWDONRFYHZMAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)